http://rdf.ncbi.nlm.nih.gov/pubchem/patent/WO-9104260-A3
Outgoing Links
| Predicate | Object |
|---|---|
| assignee | http://rdf.ncbi.nlm.nih.gov/pubchem/patentassignee/MD5_0f4246e8fcebf17c365aced017a04c61 |
| classificationCPCInventive | http://rdf.ncbi.nlm.nih.gov/pubchem/patentcpc/C07D491-22 |
| classificationIPCInventive | http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/C07D491-22 |
| filingDate | 1990-09-17-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| inventor | http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_bcb5b85f941f8a8d181c42c27921c6e5 http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_f399992089c61d01d24bd16a1f3d9541 http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_8857da1328a894136a42f4e3da44b9b9 http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_df59c625e4b46851433b11bfe3c28521 |
| publicationDate | 1991-05-02-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| publicationNumber | WO-9104260-A3 |
| titleOfInvention | 10,11-methylenedioxy-20(rs)-camptothecin and 10,11-methylenedioxy-20(s)-camptothecin analogs |
| abstract | A camptothecin analog having structures (I) or (II), where Z is H or C1-8 alkyl and R is NO2, NH2, N3, hydrogen, halogen, COOH, OH, O-C1-3 alkyl, SH, S-C1-3 alkyl, CN, CH2NH2, NH-C1-3 alkyl, CH2-NH-C1-3 alkyl, N(C1-3 alkyl)2, CH2N(C1-3 alkyl)2, O-, NH- or S-CH2CH2N(CH2CH2OH)2, O-, NH- or S-CH2CH2CH2N(CH2CH2OH)2, O-, NH- or S-CH2CH2N(CH2CH2CH2OH)2, O-, NH- or S-CH2CH2CH2N(CH2CH2CH2OH2)2, O-, NH- or S-CH2CH2N(C1-3 alkyl)2, O-, NH- or S-CH2CH2CH2N(C1-3 alkyl)2, CHO, C1-3 alkyl or NHCOCHR1NR2R3, where R1 is the side-chain of an α-amino acid and R?2 and R3¿, independently are hydrogen or a lower alkyl group or R3 is a peptide unit containing 1-3 amino acid units bonded to the nitrogen through a peptide bond; NHCO-C¿2-8?-alkylene-X or NHCO-C2-8-alkenylene-X, where X is COOH; CONR?2-(CH¿2)n-NR2R3, where n = 1-10 and R?2 and R3¿ are as defined above; NHCO-B-(CH¿2?)n-NR?2R3¿, where B = oxygen or NH, or structure (III), where m + y = 3-6, and salts thereof. |
| priorityDate | 1989-09-15-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| type | http://data.epo.org/linked-data/def/patent/Publication |
Incoming Links
Total number of triples: 30.