abstract |
Process for the preparation of phosphatidylserine of formula CH2OR1 CHOR2 CH2O-P(=O)-OCH2-CH(NH2)-COOH X wherein R1 and R2 independently represent a saturated, mono-unsaturated or polyunsaturated acyl C10-C30, X=OH or OM where M=alkaline or alkaline earth metal, ammonium, alkylammonium (including the inner salt) including the transphosphatidylation reaction between phosphatidylcholine of the general formula CH2OR1 CHOR2 CH2O-P(=O)-OR3 X wherein R1 and R2 and X have the above specified meanings, R3=CH2-CH2- NH2 or CH2-CH2-N+(CH3)3 and Serine in D, L or racemic form catalysed hy the phospholipase D enzyme (PLD), characterised in that said reaction is carried out in a hydroalcoholic medium containing an aliphatic alcohol and in the presence of bivalent metal oxide. |