abstract |
The invention relates to the use of hydroxyoleic acid and similar compounds having general formula I: COOH-CHR-(CH2)m-CH=CH-(CH2)n-CH3, wherein m and n independently represent a value of between 0 and 15 and R can denote any residue having a molecular mass of less than 200 Da. The invention relates to the use of said hydroxyoleic acid and similar compounds in the production of medicaments that are used to treat cancer, hypertension, obesity or diseases caused by an alteration of the membrane structure and the resulting regulation of G proteins or the receptors connected to same. |