http://rdf.ncbi.nlm.nih.gov/pubchem/patent/EP-0616017-A3
Outgoing Links
| Predicate | Object |
|---|---|
| assignee | http://rdf.ncbi.nlm.nih.gov/pubchem/patentassignee/MD5_1af8df51ce24ca931ae718fb747f6aa0 |
| classificationCPCInventive | http://rdf.ncbi.nlm.nih.gov/pubchem/patentcpc/B41J2-01 http://rdf.ncbi.nlm.nih.gov/pubchem/patentcpc/C09D11-30 |
| classificationIPCInventive | http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/C09D11-00 http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/B41J2-01 |
| filingDate | 1994-03-14-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| inventor | http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_a2f842bda1ae3b25f735894565caf595 http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_6c977afdb3bcb52b6c1a8eec8625499f http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_0def65bfdd7de90a76bb48146e678d94 http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_c966d4d453368203f993ecbcb9bdc6fc http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_45414d00bc6e0db387265b718a80b361 |
| publicationDate | 1995-04-26-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| publicationNumber | EP-0616017-A3 |
| titleOfInvention | Ink, process of recording by ink jet using and apparatus. |
| abstract | Provided is an ink comprising water, a water-soluble organic solvent, a coloring material and a water-soluble oligomer, wherein said water-soluble oligomer is a polymer comprising at least one of monomers represented by the formulae (I), (II) and (III): CH2=C(R)-COO-(CH2CH2O)m-(CH2)pH (I> wherein R is a hydrogen atom or a methyl group, m is an integer of 2 to 24 and p is an integer of 1 to 16, the formula CH2=C(R)-COO-(CH2CH2O)q-phenyl-(CH2)rH (II> wherein R is a hydrogen atom or a methyl group, q is an integer of 2 to 24 and r is an integer of 0 to 16, and the formula CH2=C(X)-COO-R3 (III> wherein R3 is -CH(CH2OZ1)(CH2OZ2) or -CH2{CHOZ1(CH2OZ2)}, X is a hydrogen atom or a methyl group, one of Z1 and Z2 is a hydrogen atom and the other is an alkyl group having 4 to 16 carbon atoms or a residual group of an aliphatic acid ester; or a water-soluble polyurethane obtained from monomers comprising a carboxyl type hydrophilic diol having two hydroxyl groups and one or two carboxyl groups, a diisocyanate monomer and an acetylene glycol type hydrophobic diol represented by the formula <CHEM> wherein R1 and R2 are each CH3-CH2- or <CHEM> R3 is <CHEM> and R4 is <CHEM> where n + m is N of 0 or 3 </= N </= 30. <IMAGE> |
| priorityDate | 1993-03-15-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| type | http://data.epo.org/linked-data/def/patent/Publication |
Incoming Links
Total number of triples: 102.