http://rdf.ncbi.nlm.nih.gov/pubchem/patent/CZ-20013138-A3
Outgoing Links
| Predicate | Object |
|---|---|
| assignee | http://rdf.ncbi.nlm.nih.gov/pubchem/patentassignee/MD5_4e805c393e3ac511d5e1487d200cb14f http://rdf.ncbi.nlm.nih.gov/pubchem/patentassignee/MD5_d6da79f88ca23efaeed37f242ec46100 |
| classificationIPCInventive | http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/A61P35-00 http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/A61K31-409 http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/A61P35-02 http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/C07D487-22 |
| filingDate | 2001-08-29-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| inventor | http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_cfc6240718b1097a12b89ab1f8e6ffac http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_44b9aed9b74a4b718d908dba89b579db http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_34ec5c6e54539535913c57ca8c0b679d |
| publicationDate | 2003-04-16-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| publicationNumber | CZ-20013138-A3 |
| titleOfInvention | Porphyrin-based organic compounds |
| abstract | In the present invention, there are claimed novel derivatives of 5,15-bis(p-tolyl)porphyrin and 5,10.15,20-tetrakis(p-tolyl)porphyrin of the general formula I, in which the substituents Re1 through Re8 are identical or different and are selected from the group consisting of hydrogen, alkyl having one to eight carbon atoms; the substituents Re9 and Re10 are identical or different and are selected from the group consisting of hydrogen, alkyl, phenyl, substituted phenyl wherein the substituent is represented by methyl, amino, nitro, cyano, halo, methoxy, or hydroxy group, carboxyamido guanidinium; the substituents Re11 and Re12 are identical or different substituted phenyl groups in positions 2 or 3, 5, 6, and the substituents are selected from the group consisting of hydrogen, aryl, binaphthoyl, a halogen, a cyano group, a nitro group, carboxyl and methyl through octyl esters thereof; the substituent Re13 represents oxygen O or two hydrogen atoms Hi2; the substituents X and Y, which can be identical or different denote trialkylammonium group (N(Re14)i3), in which Re14 represents alkyl, a hydroxyalkyl group, a polyhydroxyalkyl group, an aminoalkyl group, a polyaminoalkyl group; further, X and Y represent an N-substituted pyridine group wherein the substituent is represented by methyl, amino, nitro, cyano, halo, methoxy or hydroxy group, or X and Y represent a guanidinium group NH(CH=NHi2)NHRe15, aminoguanidinium group NHNH(CH=NHi2)NHRe15, methylguanidinium group CHi2NH(CH=NHi2)NHRe15, and hydroxyethyl guanidinium group OCHi2CHi2NH(CH=NHi2)NHRe15 in which Re15 denotes hydrogen, alkyl, or X and Y denote a dialkylsulfonium group S(Re16)i2, in which Re16 represents alkyl, a or X and Y represent a trialkylphosphonium group P(Re17)i3, in which Re17 denotes alkyl. Further claimed is a process for preparing the above-described derivatives as well as their use for DNA and oligonucleotide transfer into primary cells of vertebrates to influence expression of selected genes. |
| priorityDate | 2001-08-29-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| type | http://data.epo.org/linked-data/def/patent/Publication |
Incoming Links
Total number of triples: 74.