http://rdf.ncbi.nlm.nih.gov/pubchem/patent/CA-2722868-C
Outgoing Links
| Predicate | Object |
|---|---|
| assignee | http://rdf.ncbi.nlm.nih.gov/pubchem/patentassignee/MD5_237c12e5893de438efd0a9cf3f0c5167 |
| classificationCPCInventive | http://rdf.ncbi.nlm.nih.gov/pubchem/patentcpc/C09K8-64 |
| classificationIPCInventive | http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/E21B43-26 http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/C09K8-64 |
| filingDate | 2010-11-29-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| grantDate | 2017-01-03-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| inventor | http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_7c89463edabcc92323d72c7c6dc86d23 http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_d533428db857869a37c7bddf1e774da2 |
| publicationDate | 2017-01-03-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| publicationNumber | CA-2722868-C |
| titleOfInvention | Phosphate ester oil gellant |
| abstract | A composition and method of fracturing a subterranean formation. The composition includes: about 0.25 wt. % to about 3,0 wt. %, based on a weight of the hydrocarbon liquid, of a mixture of phosphate esters, said esters selected from the group consisting of: monoester PO(OR1)(OH)2, POOR2)(OH2); diester PO(OH)(OR1)(OR2)2-m where in = 0, 1, or 2; triester PO(OH)(OR1)n(OR1)(OR2)3-n where n = 0, 1, 2 or 3; and phosphoric acid H3PO4 wherein R1 and R2 each have 2 to 18 carbon atoms; and about. 0.2 wt. % to about 1.0 wt. %, based on the weight of the hydrocarbon liquid, of an acidic polynuclear aluminum compound having an Al:Cl mole ratio ranging from about 1.40:1 to about 2.2:1. The composition is added to a hydrocarbon liquid to fracture the subterranean formation with this hydrocarbon liquid. The hydrocarbon liquid containing the composition exhibits a substantially constant viscosity. |
| priorityDate | 2009-12-04-04:00^^<http://www.w3.org/2001/XMLSchema#date> |
| type | http://data.epo.org/linked-data/def/patent/Publication |
Incoming Links
Total number of triples: 54.